AskSia AI logo

AskSia

Question
Chemistry
Posted over 2 years ago
Please also explain how you calculate the initial moles, because I do not get the correct number.Calculate the pH\mathrm{pH} of the resulting solution at 25 degrees C\mathrm{C}, when 50,1ml50,1 \mathrm{ml} of 0,100 mol/0,100 \mathrm{~mol} / sodium hydroxide solution NaOH\mathrm{NaOH} has been added to 50,0ml50,0 \mathrm{ml} of;
a) 0,100 mol/I0,100 \mathrm{~mol} / \mathrm{I} hydrochloric acid HCl\mathrm{HCl} solution.
b) 0,100 mol/l0,100 \mathrm{~mol} / \mathrm{l} ethanoic acid CH3COOH\mathrm{CH} 3 \mathrm{COOH} solution. pKa\mathrm{pKa} of ethanoic acid =4,76=4,76.
Sign in to unlock the answer
Answer from Sia
Posted over 2 years ago
Solution
1
Calculate initial moles of NaOH: To find the initial moles of NaOH, use the concentration and volume of the NaOH solution. The formula is n=C×Vn = C \times V, where nn is the number of moles, CC is the concentration in mol/L, and VV is the volume in liters
2
Calculate initial moles of HCl: Similarly, calculate the initial moles of HCl using its concentration and volume
3
Reaction between NaOH and HCl: NaOH and HCl react in a 1:1 molar ratio to form water and sodium chloride. The reaction is NaOH+HClNaCl+H2O \mathrm{NaOH} + \mathrm{HCl} \rightarrow \mathrm{NaCl} + \mathrm{H_2O}
4
Determine the limiting reactant: Since both NaOH and HCl have the same molarity and nearly the same volume, they will completely neutralize each other
5
Calculate the pH: After neutralization, the pH of the resulting solution will be neutral, which is 7 at 25°C
Answer
The pH of the resulting solution after adding NaOH to HCl is 7.
Key Concept
Neutralization reaction between a strong acid and a strong base results in a neutral pH.
Explanation
Since NaOH and HCl react in a 1:1 ratio and their initial moles are equal, they completely neutralize each other, resulting in a neutral pH of 7.


---

Solution
1
Calculate initial moles of NaOH: Use the concentration and volume of the NaOH solution to find the initial moles
2
Calculate initial moles of CH3COOH: Calculate the initial moles of ethanoic acid using its concentration and volume
3
Reaction between NaOH and CH3COOH: NaOH and CH3COOH react in a 1:1 molar ratio. The reaction is NaOH+CH3COOHCH3COONa+H2O \mathrm{NaOH} + \mathrm{CH_3COOH} \rightarrow \mathrm{CH_3COONa} + \mathrm{H_2O}
4
Determine the limiting reactant: Since both NaOH and CH3COOH have the same molarity and nearly the same volume, they will completely neutralize each other
5
Calculate the pH of the buffer solution: After neutralization, the solution will contain the salt CH3COONa, which hydrolyzes to form CH3COO- and Na+. The CH3COO- will react with water to form CH3COOH and OH-. Use the Henderson-Hasselbalch equation to calculate the pH: pH=pKa+log([CH3COO][CH3COOH]) \mathrm{pH} = \mathrm{pKa} + \log \left( \frac{[\mathrm{CH_3COO^-}]}{[\mathrm{CH_3COOH}]} \right) . Since the moles of CH3COOH and CH3COO- are equal, the ratio is 1, and the log of 1 is 0
Answer
The pH of the resulting solution after adding NaOH to CH3COOH is 4.76.
Key Concept
The pH of a buffer solution can be calculated using the Henderson-Hasselbalch equation.
Explanation
After neutralization, the solution acts as a buffer with equal concentrations of CH3COOH and CH3COO-, resulting in a pH equal to the pKa of ethanoic acid.

Not the question you are looking for? Ask here!

Enter question by text

Enter question by image

Unlock Smarter Learning with AskSia Super!

Join Super, our all-in-one AI solution that can greatly improve your learning efficiency.

30% higher accuracy than GPT-4o
Entire learning journey support
The most student-friendly features
Study Other Question